Dihydrocapsaicin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl-, nonanamide |Common Name=&&Dihydrocapsaicin&&8-Methyl-N-vanillyl-, nonanamide&&6,7-Dihydr...) |
|||
Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl- | + | |SysName=N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl-nonanamide |
− | |Common Name=&&Dihydrocapsaicin&&8-Methyl-N-vanillyl- | + | |Common Name=&&Dihydrocapsaicin&&8-Methyl-N-vanillyl-nonanamide&&6,7-Dihydrocapsaicin&&Dihydro-capsaicin&& |
|CAS=19408-84-5 | |CAS=19408-84-5 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} |
Latest revision as of 12:38, 19 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 19408-84-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Dihydrocapsaicin.mol |
Dihydrocapsaicin | |
---|---|
Structural Information | |
Systematic Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-Methyl-nonanamide |
Common Name |
|
Symbol | |
Formula | C18H29NO3 |
Exact Mass | 307.21474379899996 |
Average Mass | 307.4278 |
SMILES | CC(C)CCCCCCC(=O)NCc(c1)cc(OC)c(O)c1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |