Barbaloin
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(10S)-10-.beta.-D-glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-Anthracenone |Common Name=&&(S)-10-.beta.-D-glucopyranosyl-1,8-dih...) |
|||
| (2 intermediate revisions by one user not shown) | |||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(10S)-10- | + | |SysName=(10S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone |
| − | |Common Name=&&(S)-10- | + | |Common Name=&&Barbaloin&&(S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone&&10-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-anthrone&&Aloin&&Aloin A&&Barbaloin A&& |
|CAS=1415-73-2 | |CAS=1415-73-2 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 15:24, 18 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1415-73-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Barbaloin.mol |
| Barbaloin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (10S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone |
| Common Name |
|
| Symbol | |
| Formula | C21H22O9 |
| Exact Mass | 418.126382302 |
| Average Mass | 418.39398 |
| SMILES | OCc(c4)cc(c(c(O)4)2)C([H])(c(c3)c(c(O)cc3)C(=O)2)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
