BMMCBZ1Sk007
From Metabolomics.JP
(Difference between revisions)
Line 2: | Line 2: | ||
|SysName=2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoic acid | |SysName=2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoic acid | ||
|Common Name=&&2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoate&&2,6-Dioxo-6-phenylhexa-3-enoate&& | |Common Name=&&2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoate&&2,6-Dioxo-6-phenylhexa-3-enoate&& | ||
− | |CAS= | + | |CAS=50480-67-6 |
|KEGG=C01273 | |KEGG=C01273 | ||
}} | }} |
Revision as of 09:00, 14 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 50480-67-6 |
KEGG | C01273 |
KNApSAcK | |
CDX file | |
MOL file | BMMCBZ1Sk007.mol |
2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoate | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-Hydroxy-6-oxo-6-phenylhexa-2,4-dienoic acid |
Common Name |
|
Symbol | |
Formula | C12H10O4 |
Exact Mass | 218.0579 |
Average Mass | 218.2054 |
SMILES | OC(=O)C(O)=CC=CC(=O)c(c1)cccc1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Related Atomic Mappings, Enzymes, and Pathways