BMCCPUAP0039
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=Phosphoribosyl-ATP | |SysName=Phosphoribosyl-ATP | ||
| − | |Common Name=&&Phosphoribosyl-ATP&&N1-(5-Phospho-D-ribosyl)-ATP&&1-(5-Phosphoribosyl)-ATP&& | + | |Common Name=&&Phosphoribosyl-ATP&&N1- (5-Phospho-D-ribosyl) -ATP&&1- (5-Phosphoribosyl) -ATP&& |
|CAS=1110-99-2 | |CAS=1110-99-2 | ||
|KEGG=C02739 | |KEGG=C02739 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 1110-99-2 |
| KEGG | C02739 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMCCPUAP0039.mol |
| Phosphoribosyl-ATP | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Phosphoribosyl-ATP |
| Common Name |
|
| Symbol | |
| Formula | C15H26N5O20P4 |
| Exact Mass | 720.0121 |
| Average Mass | 720.2836 |
| SMILES | O[C@@H]([C@@H](O)1)[C@@H](COP(O)(O)=O)O[C@H]1[n+1] |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
