BMAXS3AKq001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(R)-Pantothenic acid | + | |SysName= (R) -Pantothenic acid |
| − | |Common Name=&&Pantothenate&&Pantothenic acid&&(R)-Pantothenate&& | + | |Common Name=&&Pantothenate&&Pantothenic acid&& (R) -Pantothenate&& |
|CAS=79-83-4 | |CAS=79-83-4 | ||
|KEGG=C00864 | |KEGG=C00864 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79-83-4 |
| KEGG | C00864 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMAXS3AKq001.mol |
| Pantothenate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (R) -Pantothenic acid |
| Common Name |
|
| Symbol | |
| Formula | C9H17NO5 |
| Exact Mass | 219.1106 |
| Average Mass | 219.235 |
| SMILES | OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
