BMACBZHLt001
From Metabolomics.JP
(Difference between revisions)
m (BMAXCCBZt001 moved to BMACBZHLt001) |
Revision as of 12:59, 8 September 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6893-02-3 |
| KEGG | C02465 |
| KNApSAcK | |
| CDX file | |
| MOL file | BMACBZHLt001.mol |
| Triiodothyronine | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,3'5-Triiodo-L-thyronine |
| Common Name |
|
| Symbol | |
| Formula | C15H12I3NO4 |
| Exact Mass | 650.79 |
| Average Mass | 650.9744 |
| SMILES | OC(=O)[C@@H](N)Cc(c1)cc(I)c(Oc(c2)cc(I)c(O)c2)c(I) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Related Atomic Mappings, Enzymes, and Pathways
