Astragaloside IV
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(3.beta.,6.alpha.,16.beta.,20R,24S)-20,24-Epoxy-16,25-dihydroxy-3-(.beta.-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl.beta.-D-glucopyranos...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=( | + | |SysName=(3beta,6alpha,16beta,20R,24S)-20,24-Epoxy-16,25-dihydroxy-3-(beta-D-xylopyranosyloxy)-9,19-cyclolanostan-6-ylbeta-D-glucopyranoside |
| − | |Common Name=&&1H,19H-Cyclopropa[9,10]cyclopenta[a]phenanthrene | + | |Common Name=&&Astragaloside IV&&1H,19H-Cyclopropa[9,10]cyclopenta[a]phenanthrene beta-D-glucopyranoside deriv.&&9,19-Cyclolanostane beta-D-glucopyranoside deriv.&&Astrasieversianin XIV&&Astraversianin XIV&&Cyclosieversioside F&&Cyclosiversioside F&& |
|CAS=84687-43-4 | |CAS=84687-43-4 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 15:31, 18 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 84687-43-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Astragaloside IV.mol |
| Astragaloside IV | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (3beta,6alpha,16beta,20R,24S)-20,24-Epoxy-16,25-dihydroxy-3-(beta-D-xylopyranosyloxy)-9,19-cyclolanostan-6-ylbeta-D-glucopyranoside |
| Common Name |
|
| Symbol | |
| Formula | C41H68O14 |
| Exact Mass | 784.460906884 |
| Average Mass | 784.9702199999999 |
| SMILES | [H]C(C(C)(C)7)(C(CCC7OC(O8)([H])C(O)C(C(O)C8)O)23) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
