LBF20406AM40
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7069 | |LipidBank=XPR7069 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7069 |
LipidMaps | LMFA08020055 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM40.mol |
Structural Information | |
---|---|
Systematic Name | arachidonoyl- (2'-fluoroethyl) amide |
Common Name | |
Symbol | |
Formula | C22H36FNO |
Exact Mass | 349.27809297899995 |
Average Mass | 349.5257832 |
SMILES | C(CF)NC(=O)CCCC=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |