LBF20406AM17
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7033 | |LipidBank=XPR7033 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7033 |
LipidMaps | LMFA08020019 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM17.mol |
![]() | |
Structural Information | |
Systematic Name | N- (1,1-dimethyl-2-hydroxyethyl) arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C24H41NO2 |
Exact Mass | 375.313729561 |
Average Mass | 375.58788 |
SMILES | C(=CCCCC(=O)NC(CO)(C)C)CC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.50 (br s, 1H), 5.28-5.40 (m,8H), 3.57 (s, 2H), 2.78-2.90 (m, 6H), 2.02-2.20 (m, 6H), 1.62-1.74 (m, 2H), 1.20-1.40 (m, 12H), 0.89 (t, J=7.1Hz, 3H). <<7001>> |
Chromatograms |