LBF20406AM08
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7024 | |LipidBank=XPR7024 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7024 |
LipidMaps | LMFA08020010 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM08.mol |
Structural Information | |
---|---|
Systematic Name | N-isopropyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C23H39NO |
Exact Mass | 345.303164875 |
Average Mass | 345.5619 |
SMILES | C(CCCC=CCC=CCC=CCC=CCCCCC)(NC(C)C)=O |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.30-5.44 (m, 8H), 4.02-4.12 (m, 1H), 2.76-2.86 (m, 6H), 2.02-2.16 (m, 6H), 1.66-1.76 (m, 2H), 1.26-1.38 (m, 6H), 1.14 (d, J=6.6Hz, 6H), 0.89 (t, J=6.9Hz, 3H) <<7001>> |
Chromatograms |