LBF20406AM05
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7021 | |LipidBank=XPR7021 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7021 |
LipidMaps | LMFA08020007 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM05.mol |
Structural Information | |
---|---|
Systematic Name | N-methyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C21H35NO |
Exact Mass | 317.271864747 |
Average Mass | 317.50873999999993 |
SMILES | C(CC=CCC=CCC=CCC=CCCCC(NC)=O)CCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.80 (br s, lH), 5.30-5.40 (m, 8H), 2.78-2.85 (m, 9H), 2.03-2.19 (m, 6H), 1.66-1.76 (m, 2H), 1.25-1.34 (m, 6H), 0.88 (t, J=9Hz, 3H) <<7001>> |
Chromatograms |