LBF20406AM04
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR7020 | |LipidBank=XPR7020 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR7020 |
LipidMaps | LMFA08020006 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406AM04.mol |
Structural Information | |
---|---|
Systematic Name | N-ethyl arachidonoyl amide |
Common Name | |
Symbol | |
Formula | C22H37NO |
Exact Mass | 331.287514811 |
Average Mass | 331.53532 |
SMILES | C(CCC(NCC)=O)C=CCC=CCC=CCC=CCCCCC |
Physicochemical Information | |
Melting Point | colorless oil <<7001>> |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | 1H NMR (CDCl3) d5.31-5.41 (m, 8H), 3.22-3.34 (m, 2H), 2.78-2.84 (m, 6H), 1.68-1.78 (m, 4H), 1.22-1.40 (m, 6H), 1.13 (t, J=7.3, 3H), 0.88 (t, J=7.1H, 3H) <<7001>> |
Chromatograms |