LBF20306HX02
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=XPR5111 | |LipidBank=XPR5111 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR5111 |
| LipidMaps | LMFA03090004 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20306HX02.mol |
| TRIOXILIN B3 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 10,11 (S) ,12 (R) -Trihydroxyeicosa-5,8,14 (Z,Z,Z) -trienoic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H34O5 |
| Exact Mass | 354.240624198 |
| Average Mass | 354.48096000000004 |
| SMILES | [C@@H](O)([C@@H](C(O)C=CCC=CCCCC(O)=O)O)CC=CCCCCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | METHYL ESTER TRIS-TMS ETHER ; m/e 342, 315, 269, 225, 213, 129(base peak) <<1074>> |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
