LBF18106HO03
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA8038 | |LipidBank=DFA8038 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA8038 |
LipidMaps | LMFA01050135 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18106HO03.mol |
Structural Information | |
---|---|
Systematic Name | 9-Hydroxy-10-Oxo-12-Octadecenoic Acid |
Common Name | |
Symbol | |
Formula | C18H32O4 |
Exact Mass | 312.23005951199997 |
Average Mass | 312.44428 |
SMILES | CCCCCC=CCC(=O)C(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lEtOH/max=226nm(e=2900Å }400), lEtOH/max=277nm(e=1300Å }200) <<8067>> |
IR Spectra | |
NMR Spectra | 1H-NMR<<8067>>: C9(4.21ppm), C11(3.22ppm), C12,13(5.54ppm), C14(2.00ppm) |
Chromatograms |