LBF13111BC02
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA7077 | |LipidBank=DFA7077 | ||
Latest revision as of 09:00, 1 October 2008
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | DFA7077 |
| LipidMaps | LMFA01020109 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF13111BC02.mol |
| |
| Structural Information | |
| Systematic Name | (E) 2,5-Dimethyl-2-Tridecenoic Acid |
| Common Name | |
| Symbol | |
| Formula | C15H28O2 |
| Exact Mass | 240.20893013999998 |
| Average Mass | 240.38162 |
| SMILES | CCCCCCCCC(C)CC=C(C)C(O)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | 182°C/3mmHg <<7024>> |
| Density | |
| Optical Rotation | h25/D: 1.4663 <<7024>> |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax: 218.5nm, emax: 14870<<7024>> |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
