Gomisin A
From Metabolomics.JP
(Difference between revisions)
(New page: {{Hierarchy|{{PAGENAME}}}} {{Metabolite |SysName=(6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol |Common Name=&&5,6,7,8-...) |
|||
| (One intermediate revision by one user not shown) | |||
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol | |SysName=(6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol | ||
| − | |Common Name=&&5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol stereoisomer | + | |Common Name=&&Gomisin A&&5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol stereoisomer&&(+)-Gomisin A&&Besigomsin&&Schisandrol B&&Schisantherinol B&&Schizandrol B&&Wuweizi alcohol B&&Wuweizichun B&& |
|CAS=58546-54-6 | |CAS=58546-54-6 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
Latest revision as of 14:12, 12 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 58546-54-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | Gomisin A.mol |
| Gomisin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (6S,7S,13aR)-5,6,7,8-Tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethyl-benzo[3,4]cycloocta[1,2-f][1,3]benzodioxol-6-ol |
| Common Name |
|
| Symbol | |
| Formula | C23H28O7 |
| Exact Mass | 416.18350325 |
| Average Mass | 416.46422000000007 |
| SMILES | COc(c4)c(OC)c(OC)c(c43)c(c(CC(C)C(C)(O)C3)1)c(OC)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
