FLIE1CNI0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,9-Dihydroxy-8-methoxy-7-(2,3-dihydroxy-3-methylbutyl)coumestan | + | |SysName=3,9-Dihydroxy-8-methoxy-7- (2,3-dihydroxy-3-methylbutyl) coumestan |
| − | |Common Name=&&Mirificoumestan glycol&&3,9-Dihydroxy-8-methoxy-7-(2,3-dihydroxy-3-methylbutyl)coumestan&& | + | |Common Name=&&Mirificoumestan glycol&&3,9-Dihydroxy-8-methoxy-7- (2,3-dihydroxy-3-methylbutyl) coumestan&& |
|CAS=114865-43-9 | |CAS=114865-43-9 | ||
|KNApSAcK=C00010057 | |KNApSAcK=C00010057 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 114865-43-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE1CNI0003.mol |
| Mirificoumestan glycol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,9-Dihydroxy-8-methoxy-7- (2,3-dihydroxy-3-methylbutyl) coumestan |
| Common Name |
|
| Symbol | |
| Formula | C21H20O8 |
| Exact Mass | 400.11581761599996 |
| Average Mass | 400.3787 |
| SMILES | COc(c(CC(O)C(C)(C)O)1)c(O)cc(o2)c1c(C(=O)3)c2c(c4) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
