FL5FEANS0018
From Metabolomics.JP
(Redirected from INCHI:ADNCDMHZHONBRR-UHFFFAOYSA-N)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEANS Simple substitution (25 pages) : FL5FEANS0 Normal (20 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14787-34-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEANS0018.mol |
| 5-Hydroxy-3,6,7,4'-tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-3,6,7-trimethoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O7 |
| Exact Mass | 358.10525293 |
| Average Mass | 358.34202000000005 |
| SMILES | c(c3OC)c(O1)c(c(c3OC)O)C(C(=C1c(c2)ccc(OC)c2)OC)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
