FLIG1LNS0001, FLIH1LNF0001
From Metabolomics.JP
(Difference between pages)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=6-(6-Methoxy-1,3-benzodioxol-5-yl)-7H-furo[3,2-g][1]benzopyran-7-one |
| − | |Common Name=&& | + | |Common Name=&&Neorautone&&Pachyrrhizin&&6-(6-Methoxy-1,3-benzodioxol-5-yl)-7H-furo[3,2-g][1]benzopyran-7-one&& |
| − | |CAS= | + | |CAS=10091-01-7 |
| − | |KNApSAcK= | + | |KNApSAcK=C00009783 |
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10091-01-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIH1LNF0001.mol |
| Neorautone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6-(6-Methoxy-1,3-benzodioxol-5-yl)-7H-furo[3,2-g][1]benzopyran-7-one |
| Common Name |
|
| Symbol | |
| Formula | C19H12O6 |
| Exact Mass | 336.063388116 |
| Average Mass | 336.29498 |
| SMILES | c(c45)c(c(OC)cc4OCO5)C(=C3)C(=O)Oc(c32)cc(c1c2)occ |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
