FLICWXNS0002, FLICWXNS0003
From Metabolomics.JP
(Difference between pages)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=7, | + | |SysName=Sepiol&&7,2',3'-Trihydroxy-4'-methoxyisoflavene |
| − | |Common Name=&& | + | |Common Name=&&Sepiol&&7,2',3'-Trihydroxy-4'-methoxyisoflavene&& |
| − | |CAS= | + | |CAS=60434-16-4 |
| − | |KNApSAcK= | + | |KNApSAcK=C00009750 |
}} | }} | ||
Revision as of 09:00, 1 February 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 60434-16-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLICWXNS0003.mol |
| Sepiol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Sepiol&&7,2',3'-Trihydroxy-4'-methoxyisoflavene |
| Common Name |
|
| Symbol | |
| Formula | C16H14O5 |
| Exact Mass | 286.084123558 |
| Average Mass | 286.27936 |
| SMILES | COc(c3)c(O)c(O)c(c3)C(C1)=Cc(c2)c(cc(O)c2)O1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
