<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYS4ESa001</id>
		<title>Mol:BMFYS4ESa001 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYS4ESa001"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;action=history"/>
		<updated>2026-09-16T04:25:22Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178064&amp;oldid=prev</id>
		<title>Editor at 01:43, 17 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178064&amp;oldid=prev"/>
				<updated>2010-06-17T01:43:45Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 01:43, 17 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 116:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 116:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYS4ESa001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYS4ESa001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] (3R) -3-hydroxybutanethioic acid &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] (3R) -3-hydroxybutanethioic acid &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;21804-29-5 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;CAS_RN	&lt;/ins&gt;21804-29-5 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C25H42N7O18P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C25H42N7O18P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	853.1519 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	853.1519 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178063&amp;oldid=prev</id>
		<title>Editor at 01:43, 17 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178063&amp;oldid=prev"/>
				<updated>2010-06-17T01:43:35Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 01:43, 17 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 115:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 115:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 7 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYS4ESa001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYS4ESa001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	(&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;R&lt;/del&gt;)-3-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;Hydroxy&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;butanoyl&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;CoA &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;S- [2- [3- [ [4- [ [ [(2R,3S,4R,5R) -5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethyl] &lt;/ins&gt;(&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;3R&lt;/ins&gt;) -3-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;hydroxybutanethioic acid &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;21804&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;29&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;5 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C25H42N7O18P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C25H42N7O18P3S &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	853.1519 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	853.1519 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178062&amp;oldid=prev</id>
		<title>Editor at 00:00, 14 March 2009</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178062&amp;oldid=prev"/>
				<updated>2009-03-14T00:00:00Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;a href=&quot;http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;amp;diff=178062&amp;amp;oldid=178061&quot;&gt;Show changes&lt;/a&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178061&amp;oldid=prev</id>
		<title>Editor at 00:00, 7 October 2008</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYS4ESa001&amp;diff=178061&amp;oldid=prev"/>
				<updated>2008-10-07T00:00:00Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt;&amp;lt;pre&amp;gt;&lt;br /&gt;
&lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/&lt;br /&gt;
 54 56  0  0  1  0  0  0  0  0999 V2000&lt;br /&gt;
    4.6254   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    3.6473   -3.3593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    2.9781   -4.1024    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    3.2872   -5.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    4.9344   -4.5183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    2.0000   -3.8945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.9825   -2.5373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.1165   -2.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.1165   -1.0373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.9825   -0.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.8486   -1.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.8486   -2.0373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.5917   -0.3681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.1850    0.5454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.1904    0.4409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   23.7146   -2.5373    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.5213    1.1840    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.7292    2.1622    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.8632    2.6622    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.1201    1.9930    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   19.1419    2.2010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.6428    2.5689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.7587    3.6567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.5268    1.0795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   18.4728    1.4578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   21.5677    4.2445    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.1555    3.4355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   20.9799    5.0535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   22.3767    4.8323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.4946    1.6657    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.2867    0.6876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   17.7025    2.6439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   16.5165    1.8736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.8474    1.1305    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   16.5905    0.4614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.1042    1.7996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   15.1782    0.3873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   14.2001    0.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   13.5309   -0.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   14.2741   -0.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   12.7878    0.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   12.8618   -0.8910    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.8837   -0.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.2145   -1.4263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   10.2364   -1.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    9.5673   -1.9615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    8.5891   -1.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    7.9200   -2.4967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    6.9418   -2.2888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    6.2727   -3.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    5.2946   -2.8241    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   13.1708   -1.8421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
   11.5747    0.2679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
    8.2801   -0.8025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0&lt;br /&gt;
 20 24  1  6  0  0  0&lt;br /&gt;
 19 20  1  0  0  0  0&lt;br /&gt;
 17 24  1  6  0  0  0&lt;br /&gt;
 19 18  1  0  0  0  0&lt;br /&gt;
 17 18  1  0  0  0  0&lt;br /&gt;
 20 21  1  0  0  0  0&lt;br /&gt;
 21 25  1  0  0  0  0&lt;br /&gt;
 17 15  1  0  0  0  0&lt;br /&gt;
 25 30  1  0  0  0  0&lt;br /&gt;
 30 32  1  0  0  0  0&lt;br /&gt;
 30 31  2  0  0  0  0&lt;br /&gt;
 30 33  1  0  0  0  0&lt;br /&gt;
 37 34  1  0  0  0  0&lt;br /&gt;
 34 36  2  0  0  0  0&lt;br /&gt;
 34 35  1  0  0  0  0&lt;br /&gt;
 37 38  1  0  0  0  0&lt;br /&gt;
 34 33  1  0  0  0  0&lt;br /&gt;
 38 39  1  0  0  0  0&lt;br /&gt;
 39 42  1  0  0  0  0&lt;br /&gt;
 39 41  1  0  0  0  0&lt;br /&gt;
 39 40  1  0  0  0  0&lt;br /&gt;
 42 43  1  0  0  0  0&lt;br /&gt;
 42 52  1  1  0  0  0&lt;br /&gt;
 43 53  2  0  0  0  0&lt;br /&gt;
 43 44  1  0  0  0  0&lt;br /&gt;
 44 45  1  0  0  0  0&lt;br /&gt;
 45 46  1  0  0  0  0&lt;br /&gt;
 46 47  1  0  0  0  0&lt;br /&gt;
 47 48  1  0  0  0  0&lt;br /&gt;
 47 54  2  0  0  0  0&lt;br /&gt;
 48 49  1  0  0  0  0&lt;br /&gt;
 49 50  1  0  0  0  0&lt;br /&gt;
 50 51  1  0  0  0  0&lt;br /&gt;
 18 22  1  1  0  0  0&lt;br /&gt;
 19 23  1  1  0  0  0&lt;br /&gt;
 27 26  1  0  0  0  0&lt;br /&gt;
 26 29  1  0  0  0  0&lt;br /&gt;
 26 28  2  0  0  0  0&lt;br /&gt;
 23 26  1  0  0  0  0&lt;br /&gt;
 51  1  1  0  0  0  0&lt;br /&gt;
  1  2  1  0  0  0  0&lt;br /&gt;
  1  5  2  0  0  0  0&lt;br /&gt;
 11 12  1  0  0  0  0&lt;br /&gt;
 10  9  1  0  0  0  0&lt;br /&gt;
  9  8  2  0  0  0  0&lt;br /&gt;
  8  7  1  0  0  0  0&lt;br /&gt;
  7 12  2  0  0  0  0&lt;br /&gt;
 11 10  2  0  0  0  0&lt;br /&gt;
 15 14  1  0  0  0  0&lt;br /&gt;
 14 13  2  0  0  0  0&lt;br /&gt;
 13 11  1  0  0  0  0&lt;br /&gt;
 10 15  1  0  0  0  0&lt;br /&gt;
 12 16  1  0  0  0  0&lt;br /&gt;
  2  3  1  0  0  0  0&lt;br /&gt;
  3  4  1  1  0  0  0&lt;br /&gt;
  3  6  1  0  0  0  0&lt;br /&gt;
S  SKP  7&lt;br /&gt;
ID	BMFYS4ESa001&lt;br /&gt;
NAME	(R)-3-Hydroxy-butanoyl-CoA&lt;br /&gt;
FORMULA	C25H42N7O18P3S&lt;br /&gt;
EXACTMASS	853.1519&lt;br /&gt;
AVERAGEMASS	853.6246&lt;br /&gt;
SMILES	n(c3N)cnc(c32)n(cn2)[C@@H]([C@@H]1O)O[C@@H]([C@H]1OP(O)(O)=O)COP(OP(O)(=O)OCC([C@@H](O)C(NCCC(NCCSC(C[C@@H](C)O)=O)=O)=O)(C)C)(O)=O&lt;br /&gt;
KEGG	http://www.genome.jp/dbget-bin/www_bget?compound+C03561&lt;br /&gt;
M  END&lt;br /&gt;
&amp;lt;/pre&amp;gt;&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>