<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYB8HO0001</id>
		<title>Mol:BMFYB8HO0001 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMFYB8HO0001"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;action=history"/>
		<updated>2026-09-16T22:12:46Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177685&amp;oldid=prev</id>
		<title>Editor at 09:10, 16 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177685&amp;oldid=prev"/>
				<updated>2010-06-16T09:10:08Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 09:10, 16 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 72:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 72:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177684&amp;oldid=prev</id>
		<title>Editor at 09:09, 16 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177684&amp;oldid=prev"/>
				<updated>2010-06-16T09:09:46Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 09:09, 16 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 65:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 65:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 29 31&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 29 31&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 2&amp;#160; 3&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 2&amp;#160; 3&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;7 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;NAME	(S) -2,3-Epoxysqualene &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8HO0001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8HO0001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;NAME	(3S) -2,2-Dimethyl-3- [(7E) -3,7,12,16,20-pentamethylhenicosa- 3,7,11,15,19-pentaenyl] oxirane &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;CAS_RN	9029-62-3 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177683&amp;oldid=prev</id>
		<title>Editor at 06:14, 19 March 2009</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177683&amp;oldid=prev"/>
				<updated>2009-03-19T06:14:21Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 06:14, 19 March 2009&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 66:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 66:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 2&amp;#160; 3&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160;&amp;#160; 2&amp;#160; 3&amp;#160; 1&amp;#160; 0&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 6 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; 6 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;del class=&quot;diffchange diffchange-inline&quot;&gt; &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;(S) -2,3-Epoxysqualene &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8HO0001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMFYB8HO0001 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177682&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/   31 31  0  0  1  0  0  0  0  0999 V2000     17.4762  -22.7718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0     18.6481  -23.4637  ...</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB8HO0001&amp;diff=177682&amp;oldid=prev"/>
				<updated>2009-03-19T06:13:55Z</updated>
		
		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/   31 31  0  0  1  0  0  0  0  0999 V2000     17.4762  -22.7718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0     18.6481  -23.4637  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 31 31  0  0  1  0  0  0  0  0999 V2000 &lt;br /&gt;
   17.4762  -22.7718    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6481  -23.4637    0.0000 C   0  0  3  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   17.5012  -24.0685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   17.4762  -21.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.6840  -24.0756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6356  -25.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6481  -20.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.8390  -21.4001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.8390  -22.7718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.8265  -19.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   21.0359  -23.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.2330  -22.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.2905  -21.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   21.0234  -20.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.2841  -19.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   21.0110  -19.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.2141  -18.6134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.4299  -19.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.4237  -20.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.6393  -21.3940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.4610  -22.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.8550  -20.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.8488  -19.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.6393  -18.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.6581  -17.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.2429  -17.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.8488  -16.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.0770  -17.1858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.1019  -18.5885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.1019  -19.8977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   28.2802  -17.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0     0  0 &lt;br /&gt;
  1  3  1  1     0  0 &lt;br /&gt;
  1  4  1  0     0  0 &lt;br /&gt;
  2  5  1  0     0  0 &lt;br /&gt;
  2  6  1  0     0  0 &lt;br /&gt;
  4  7  1  0     0  0 &lt;br /&gt;
  7  8  1  0     0  0 &lt;br /&gt;
  8  9  2  0     0  0 &lt;br /&gt;
  8 10  1  0     0  0 &lt;br /&gt;
  9 11  1  0     0  0 &lt;br /&gt;
 11 12  1  0     0  0 &lt;br /&gt;
 12 13  1  0     0  0 &lt;br /&gt;
 13 14  2  0     0  0 &lt;br /&gt;
 13 15  1  0     0  0 &lt;br /&gt;
 14 16  1  0     0  0 &lt;br /&gt;
 16 17  1  0     0  0 &lt;br /&gt;
 17 18  1  0     0  0 &lt;br /&gt;
 18 19  2  0     0  0 &lt;br /&gt;
 19 20  1  0     0  0 &lt;br /&gt;
 19 21  1  0     0  0 &lt;br /&gt;
 20 22  1  0     0  0 &lt;br /&gt;
 22 23  1  0     0  0 &lt;br /&gt;
 23 24  2  0     0  0 &lt;br /&gt;
 24 25  1  0     0  0 &lt;br /&gt;
 24 26  1  0     0  0 &lt;br /&gt;
 25 27  1  0     0  0 &lt;br /&gt;
 27 28  1  0     0  0 &lt;br /&gt;
 28 29  2  0     0  0 &lt;br /&gt;
 29 30  1  0     0  0 &lt;br /&gt;
 29 31  1  0     0  0 &lt;br /&gt;
  2  3  1  0     0  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
NAME	 &lt;br /&gt;
ID	BMFYB8HO0001 &lt;br /&gt;
FORMULA	C30H50O &lt;br /&gt;
EXACTMASS	426.386166222 &lt;br /&gt;
AVERAGEMASS	426.7174 &lt;br /&gt;
SMILES	C(C)(=CCCC=C(C)CCC=C(C)CCC=C(C)C)CCC=C(C)CC[C@H](O1)C1(C)C &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>