http://metabolomics.jp/mediawiki/index.php?action=history&feed=atom&title=Mol%3ABMFYB4ESa008
Mol:BMFYB4ESa008 - Revision history
2026-05-18T10:48:34Z
Revision history for this page on the wiki
MediaWiki 1.19.1
http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB4ESa008&diff=177464&oldid=prev
Editor at 08:34, 16 June 2010
2010-06-16T08:34:55Z
<p></p>
<table class='diff diff-contentalign-left'>
<col class='diff-marker' />
<col class='diff-content' />
<col class='diff-marker' />
<col class='diff-content' />
<tr valign='top'>
<td colspan='2' style="background-color: white; color:black;">← Older revision</td>
<td colspan='2' style="background-color: white; color:black;">Revision as of 08:34, 16 June 2010</td>
</tr><tr><td colspan="2" class="diff-lineno">Line 121:</td>
<td colspan="2" class="diff-lineno">Line 121:</td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>   5  6  1  0  0  0  0  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>   5  6  1  0  0  0  0  </div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>   5  8  1  0  0  0  0  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>   5  8  1  0  0  0  0  </div></td></tr>
<tr><td class='diff-marker'>−</td><td style="background: #ffa; color:black; font-size: smaller;"><div>S  SKP  <del class="diffchange diffchange-inline">6 </del></div></td><td class='diff-marker'>+</td><td style="background: #cfc; color:black; font-size: smaller;"><div>S  SKP  <ins class="diffchange diffchange-inline">7 </ins></div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>ID BMFYB4ESa008  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>ID BMFYB4ESa008  </div></td></tr>
<tr><td class='diff-marker'>−</td><td style="background: #ffa; color:black; font-size: smaller;"><div>NAME <del class="diffchange diffchange-inline">D</del>-<del class="diffchange diffchange-inline">Carnitinyl</del>-<del class="diffchange diffchange-inline">CoA </del></div></td><td class='diff-marker'>+</td><td style="background: #cfc; color:black; font-size: smaller;"><div>NAME <ins class="diffchange diffchange-inline">[4</ins>- <ins class="diffchange diffchange-inline">[2</ins>- <ins class="diffchange diffchange-inline">[3- [ [4- [ [ [5- (6-Aminopurin-9-yl) -4-hydroxy-3-phosphonooxyoxolan-2-yl] methoxy-hydroxyphosphoryl] oxy-hydroxyphosphoryl] oxy-2-hydroxy-3,3-dimethylbutanoyl] amino] propanoylamino] ethylsulfanyl] -2-hydroxy-4-oxobutyl] -trimethylazanium </ins></div></td></tr>
<tr><td colspan="2"> </td><td class='diff-marker'>+</td><td style="background: #cfc; color:black; font-size: smaller;"><div><ins class="diffchange diffchange-inline">CAS_RN 369647-14-3 </ins></div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>FORMULA C28H51N8O18P3S  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>FORMULA C28H51N8O18P3S  </div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>EXACTMASS 912.2254  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>EXACTMASS 912.2254  </div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>AVERAGEMASS 912.7349  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>AVERAGEMASS 912.7349  </div></td></tr>
<tr><td colspan="2"> </td><td class='diff-marker'>+</td><td style="background: #cfc; color:black; font-size: smaller;"><div><ins style="color: red; font-weight: bold; text-decoration: none;">SMILES C(C(=O)NCC[SH+1]C(C[C@H](C[N+1](C)(C)C)O)=O)CNC(=O)[C@H](O)C(COP(O)(=O)OP(OC[C@H]([C@H]3OP(O)(O)=O)O[C@H]([C@@H]3O)n(c21)cnc1c(N)ncn2)(O)=O)(C)C </ins></div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>SMILES C([SH+1]C(=O)C[C@H](C[N+1](C)(C)C)O)CNC(CCNC(=O)[C@@H](C(C)(C)COP(OP(OC[C@H]([C@@H](OP(O)(O)=O)1)O[C@@H](n(c23)cnc2c(ncn3)N)[C@@H]1O)(O)=O)(O)=O)O)=O  </div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>SMILES C([SH+1]C(=O)C[C@H](C[N+1](C)(C)C)O)CNC(CCNC(=O)[C@@H](C(C)(C)COP(OP(OC[C@H]([C@@H](OP(O)(O)=O)1)O[C@@H](n(c23)cnc2c(ncn3)N)[C@@H]1O)(O)=O)(O)=O)O)=O  </div></td></tr>
<tr><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>M  END</div></td><td class='diff-marker'> </td><td style="background: #eee; color:black; font-size: smaller;"><div>M  END</div></td></tr>
</table>
Editor
http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB4ESa008&diff=177463&oldid=prev
Editor at 00:00, 14 March 2009
2009-03-14T00:00:00Z
<p></p>
<a href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB4ESa008&diff=177463&oldid=177462">Show changes</a>
Editor
http://metabolomics.jp/mediawiki/index.php?title=Mol:BMFYB4ESa008&diff=177462&oldid=prev
Editor at 00:00, 7 October 2008
2008-10-07T00:00:00Z
<p></p>
<p><b>New page</b></p><div><pre><br />
<br />
Copyright: ARM project http://www.metabolome.jp/<br />
58 60 0 0 1 0 0 0 0 0999 V2000<br />
6.0377 -3.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
5.0596 -3.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
4.3904 -3.9388 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0<br />
3.4123 -3.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
2.7431 -4.4740 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0<br />
3.4863 -5.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
2.0740 -5.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
2.0000 -3.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
6.3467 -4.3546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
4.6994 -4.8898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
23.3948 -2.3736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.5288 -1.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.5288 -0.8736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
23.3948 -0.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
24.2608 -0.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
24.2608 -1.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
25.0040 -0.2045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
24.5972 0.7091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
23.6027 0.6045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
25.1269 -2.3736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.9336 1.3477 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0<br />
23.1415 2.3258 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0<br />
22.2755 2.8258 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0<br />
21.5323 2.1567 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0<br />
20.5542 2.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
24.0551 2.7326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.1710 3.8204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
21.9391 1.2432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
19.8851 1.6215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.9800 4.4081 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0<br />
23.5678 3.5991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
22.3922 5.2172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
23.7890 4.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
18.9069 1.8294 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0<br />
18.6990 0.8512 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
19.1148 2.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
17.9288 2.0373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
17.2596 1.2941 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0<br />
18.0028 0.6250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
16.5165 1.9633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
16.5905 0.5510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
15.6124 0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
14.9432 0.0158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
15.6864 -0.6534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
14.2001 0.6849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
14.2741 -0.7274 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0<br />
13.2959 -0.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
12.6268 -1.2626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
11.6487 -1.0547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
10.9795 -1.7978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
10.0014 -1.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
9.3323 -2.3331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0<br />
8.3541 -2.1252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
7.6850 -2.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0<br />
6.7068 -2.6604 0.0000 S 0 3 0 0 0 0 0 0 0 0 0 0<br />
14.5831 -1.6784 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
12.9869 0.4316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
9.6924 -0.6389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0<br />
11 16 2 0 0 0 0<br />
11 12 1 0 0 0 0<br />
12 13 2 0 0 0 0<br />
13 14 1 0 0 0 0<br />
15 16 1 0 0 0 0<br />
15 14 2 0 0 0 0<br />
19 18 1 0 0 0 0<br />
18 17 2 0 0 0 0<br />
17 15 1 0 0 0 0<br />
14 19 1 0 0 0 0<br />
16 20 1 0 0 0 0<br />
24 28 1 6 0 0 0<br />
23 24 1 0 0 0 0<br />
21 28 1 6 0 0 0<br />
23 22 1 0 0 0 0<br />
21 22 1 0 0 0 0<br />
24 25 1 0 0 0 0<br />
25 29 1 0 0 0 0<br />
21 19 1 0 0 0 0<br />
29 34 1 0 0 0 0<br />
34 36 1 0 0 0 0<br />
34 35 2 0 0 0 0<br />
34 37 1 0 0 0 0<br />
41 38 1 0 0 0 0<br />
38 40 2 0 0 0 0<br />
38 39 1 0 0 0 0<br />
41 42 1 0 0 0 0<br />
38 37 1 0 0 0 0<br />
42 43 1 0 0 0 0<br />
43 46 1 0 0 0 0<br />
43 45 1 0 0 0 0<br />
43 44 1 0 0 0 0<br />
46 47 1 0 0 0 0<br />
46 56 1 1 0 0 0<br />
47 57 2 0 0 0 0<br />
47 48 1 0 0 0 0<br />
48 49 1 0 0 0 0<br />
49 50 1 0 0 0 0<br />
50 51 1 0 0 0 0<br />
51 52 1 0 0 0 0<br />
51 58 2 0 0 0 0<br />
52 53 1 0 0 0 0<br />
53 54 1 0 0 0 0<br />
54 55 1 0 0 0 0<br />
22 26 1 1 0 0 0<br />
23 27 1 1 0 0 0<br />
31 30 1 0 0 0 0<br />
30 33 1 0 0 0 0<br />
30 32 2 0 0 0 0<br />
27 30 1 0 0 0 0<br />
55 1 1 0 0 0 0<br />
1 2 1 0 0 0 0<br />
1 9 2 0 0 0 0<br />
2 3 1 0 0 0 0<br />
3 4 1 0 0 0 0<br />
3 10 1 1 0 0 0<br />
4 5 1 0 0 0 0<br />
5 7 1 0 0 0 0<br />
5 6 1 0 0 0 0<br />
5 8 1 0 0 0 0<br />
S SKP 6<br />
ID BMFYB4ESa008<br />
NAME D-Carnitinyl-CoA<br />
FORMULA C28H51N8O18P3S<br />
EXACTMASS 912.2254<br />
AVERAGEMASS 912.7349<br />
SMILES C([SH+1]C(=O)C[C@H](C[N+1](C)(C)C)O)CNC(CCNC(=O)[C@@H](C(C)(C)COP(OP(OC[C@H]([C@@H](OP(O)(O)=O)1)O[C@@H](n(c23)cnc2c(ncn3)N)[C@@H]1O)(O)=O)(O)=O)O)=O<br />
M END<br />
</pre></div>
Editor