<?xml version="1.0"?>
<?xml-stylesheet type="text/css" href="http://metabolomics.jp/mediawiki/skins/common/feed.css?303"?>
<feed xmlns="http://www.w3.org/2005/Atom" xml:lang="en">
		<id>http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMCCCC--q031</id>
		<title>Mol:BMCCCC--q031 - Revision history</title>
		<link rel="self" type="application/atom+xml" href="http://metabolomics.jp/mediawiki/index.php?action=history&amp;feed=atom&amp;title=Mol%3ABMCCCC--q031"/>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMCCCC--q031&amp;action=history"/>
		<updated>2026-09-17T05:01:00Z</updated>
		<subtitle>Revision history for this page on the wiki</subtitle>
		<generator>MediaWiki 1.19.1</generator>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMCCCC--q031&amp;diff=176541&amp;oldid=prev</id>
		<title>Editor at 08:35, 11 June 2010</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMCCCC--q031&amp;diff=176541&amp;oldid=prev"/>
				<updated>2010-06-11T08:35:18Z</updated>
		
		<summary type="html">&lt;p&gt;&lt;/p&gt;
&lt;table class='diff diff-contentalign-left'&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
				&lt;col class='diff-marker' /&gt;
				&lt;col class='diff-content' /&gt;
			&lt;tr valign='top'&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;← Older revision&lt;/td&gt;
			&lt;td colspan='2' style=&quot;background-color: white; color:black;&quot;&gt;Revision as of 08:35, 11 June 2010&lt;/td&gt;
			&lt;/tr&gt;&lt;tr&gt;&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 74:&lt;/td&gt;
&lt;td colspan=&quot;2&quot; class=&quot;diff-lineno&quot;&gt;Line 74:&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 15 33&amp;#160; 1&amp;#160; 6&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 15 33&amp;#160; 1&amp;#160; 6&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 18 34&amp;#160; 1&amp;#160; 1&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&amp;#160; 18 34&amp;#160; 1&amp;#160; 1&amp;#160; &amp;#160;  0&amp;#160; 0 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;del class=&quot;diffchange diffchange-inline&quot;&gt;6 &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;S&amp;#160; SKP&amp;#160; &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;7 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;−&lt;/td&gt;&lt;td style=&quot;background: #ffa; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	4,4&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;'&lt;/del&gt;,&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;14alpha&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;Trimethyl&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;5alpha&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;cholesta&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;8&lt;/del&gt;,&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;24&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;dien&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;3beta&lt;/del&gt;-&lt;del class=&quot;diffchange diffchange-inline&quot;&gt;ol &lt;/del&gt;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;NAME	&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;(3S,5R,10S,13R,14R,17R) -&lt;/ins&gt;4,4,&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;10,13,14&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;Pentamethyl&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;17&lt;/ins&gt;- &lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;[(2R) &lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;6-methylhept-5-en-2-yl] -2&lt;/ins&gt;,&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;3,5,6,7,11,12,15,16,17&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;decahydro-1H-cyclopenta[a]phenant &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;CAS_RN	 79&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;63&lt;/ins&gt;-&lt;ins class=&quot;diffchange diffchange-inline&quot;&gt;0 &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMCCCC--q031 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;ID	BMCCCC--q031 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;FORMULA	C30H50O &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;EXACTMASS	426.386166222 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;AVERAGEMASS	426.7174 &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td colspan=&quot;2&quot;&gt;&amp;#160;&lt;/td&gt;&lt;td class='diff-marker'&gt;+&lt;/td&gt;&lt;td style=&quot;background: #cfc; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;&lt;ins style=&quot;color: red; font-weight: bold; text-decoration: none;&quot;&gt;SMILES	C([C@@]4(C)1)C[C@H](O)C(C)(C)[C@](CCC(=C34)[C@]([C@@](CC3)(C)2)(C)CC[C@]2([H])[C@]([H])(C)CCC=C(C)C)1[H] &lt;/ins&gt;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C([C@@]4(C)1)C[C@H](O)C(C)(C)[C@](CCC(=C34)[C@]([C@@](CC3)(C)2)(C)CC[C@]2([H])[C@]([H])(C)CCC=C(C)C)1[H] &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;SMILES	C([C@@]4(C)1)C[C@H](O)C(C)(C)[C@](CCC(=C34)[C@]([C@@](CC3)(C)2)(C)CC[C@]2([H])[C@]([H])(C)CCC=C(C)C)1[H] &amp;#160;&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;tr&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;td class='diff-marker'&gt;&amp;#160;&lt;/td&gt;&lt;td style=&quot;background: #eee; color:black; font-size: smaller;&quot;&gt;&lt;div&gt;M&amp;#160; END&lt;/div&gt;&lt;/td&gt;&lt;/tr&gt;
&lt;/table&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	<entry>
		<id>http://metabolomics.jp/mediawiki/index.php?title=Mol:BMCCCC--q031&amp;diff=176540&amp;oldid=prev</id>
		<title>Editor: New page:     Copyright: ARM project http://www.metabolome.jp/   34 37  0  0  1  0  0  0  0  0999 V2000     20.9122  -17.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0     22.0226  -16.6205  ...</title>
		<link rel="alternate" type="text/html" href="http://metabolomics.jp/mediawiki/index.php?title=Mol:BMCCCC--q031&amp;diff=176540&amp;oldid=prev"/>
				<updated>2009-03-19T06:21:46Z</updated>
		
		<summary type="html">&lt;p&gt;New page:     Copyright: ARM project http://www.metabolome.jp/   34 37  0  0  1  0  0  0  0  0999 V2000     20.9122  -17.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0     22.0226  -16.6205  ...&lt;/p&gt;
&lt;p&gt;&lt;b&gt;New page&lt;/b&gt;&lt;/p&gt;&lt;div&gt; &lt;br /&gt;
 &lt;br /&gt;
Copyright: ARM project http://www.metabolome.jp/ &lt;br /&gt;
 34 37  0  0  1  0  0  0  0  0999 V2000 &lt;br /&gt;
   20.9122  -17.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.0226  -16.6205    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.7445  -16.6586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.9122  -18.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.0418  -15.3260    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.3389  -16.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.1242  -17.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6149  -17.3250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.7380  -15.3387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   19.8334  -19.3176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.1968  -14.6469    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   20.8995  -14.6661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.0229  -13.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.3516  -15.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.5895  -18.6006    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   17.4536  -16.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6470  -15.7962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.1904  -13.2635    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   17.4663  -19.3303    0.0000 C   0  0  3  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   16.2986  -17.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.3770  -12.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   22.0610  -12.5782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   16.3113  -18.6703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   16.3299  -20.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.0120  -20.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   25.5766  -13.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   15.1182  -19.3684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   26.7695  -12.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.9690  -13.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   29.1619  -12.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   27.9753  -14.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   24.5675  -14.3669    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   18.6719  -19.7810    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
   23.1777  -11.6010    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0 &lt;br /&gt;
  1  2  1  0     0  0 &lt;br /&gt;
  1  3  2  0     0  0 &lt;br /&gt;
  1  4  1  0     0  0 &lt;br /&gt;
  2  5  1  0     0  0 &lt;br /&gt;
  2  6  1  0     0  0 &lt;br /&gt;
  2  7  1  6     0  0 &lt;br /&gt;
  3  8  1  0     0  0 &lt;br /&gt;
  3  9  1  0     0  0 &lt;br /&gt;
  4 10  1  0     0  0 &lt;br /&gt;
  5 11  1  0     0  0 &lt;br /&gt;
  5 12  1  0     0  0 &lt;br /&gt;
  5 13  1  1     0  0 &lt;br /&gt;
  6 14  1  0     0  0 &lt;br /&gt;
  8 15  1  0     0  0 &lt;br /&gt;
  8 16  1  0     0  0 &lt;br /&gt;
  8 17  1  1     0  0 &lt;br /&gt;
 11 18  1  0     0  0 &lt;br /&gt;
 15 19  1  0     0  0 &lt;br /&gt;
 16 20  1  0     0  0 &lt;br /&gt;
 18 21  1  0     0  0 &lt;br /&gt;
 18 22  1  6     0  0 &lt;br /&gt;
 19 23  1  0     0  0 &lt;br /&gt;
 19 24  1  1     0  0 &lt;br /&gt;
 19 25  1  6     0  0 &lt;br /&gt;
 21 26  1  0     0  0 &lt;br /&gt;
 23 27  1  1     0  0 &lt;br /&gt;
 26 28  1  0     0  0 &lt;br /&gt;
 28 29  2  0     0  0 &lt;br /&gt;
 29 30  1  0     0  0 &lt;br /&gt;
 29 31  1  0     0  0 &lt;br /&gt;
  9 12  1  0     0  0 &lt;br /&gt;
 10 15  1  0     0  0 &lt;br /&gt;
 11 14  1  0     0  0 &lt;br /&gt;
 20 23  1  0     0  0 &lt;br /&gt;
 11 32  1  6     0  0 &lt;br /&gt;
 15 33  1  6     0  0 &lt;br /&gt;
 18 34  1  1     0  0 &lt;br /&gt;
S  SKP  6 &lt;br /&gt;
NAME	4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol &lt;br /&gt;
ID	BMCCCC--q031 &lt;br /&gt;
FORMULA	C30H50O &lt;br /&gt;
EXACTMASS	426.386166222 &lt;br /&gt;
AVERAGEMASS	426.7174 &lt;br /&gt;
SMILES	C([C@@]4(C)1)C[C@H](O)C(C)(C)[C@](CCC(=C34)[C@]([C@@](CC3)(C)2)(C)CC[C@]2([H])[C@]([H])(C)CCC=C(C)C)1[H] &lt;br /&gt;
M  END&lt;/div&gt;</summary>
		<author><name>Editor</name></author>	</entry>

	</feed>